C17H26O4 — CID 11369894
[(1S,2R,4aR,5R,8R,8aR)-1,8a-dihydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate (PubChem CID 11369894) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is [(1S,2R,4aR,5R,8R,8aR)-1,8a-dihydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate.
| Compound Name | [(1S,2R,4aR,5R,8R,8aR)-1,8a-dihydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 11369894 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | [(1S,2R,4aR,5R,8R,8aR)-1,8a-dihydroxy-3,8-dimethyl-5-prop-1-en-2-yl-2,4a,5,6,7,8-hexahydro-1H-naphthalen-2-yl] acetate |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C)[C@@]2(O)[C@@H]1C=C(C)[C@@H](OC(C)=O)[C@@H]2O |
| InChI | InChI=1S/C17H26O4/c1-9(2)13-7-6-11(4)17(20)14(13)8-10(3)15(16(17)19)21-12(5)18/h8,11,13-16,19-20H,1,6-7H2,2-5H3/t11-,13+,14-,15-,16+,17-/m1/s1 |
| InChIKey | RXHIKAIVEMAPRU-JRIGQVHBSA-N |
| XLogP | 2.21 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|