C14H16O2Se — CID 11369911
(3aS,7S,7aR)-7-phenylselanyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one (PubChem CID 11369911) has the molecular formula C14H16O2Se and a molecular weight of 295.24 g/mol. Its IUPAC name is (3aS,7S,7aR)-7-phenylselanyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one.
| Compound Name | (3aS,7S,7aR)-7-phenylselanyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 11369911 |
| Molecular Formula | C14H16O2Se |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | (3aS,7S,7aR)-7-phenylselanyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
| SMILES | O=C1OC[C@H]2CCC[C@H]([Se]c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C14H16O2Se/c15-14-13-10(9-16-14)5-4-8-12(13)17-11-6-2-1-3-7-11/h1-3,6-7,10,12-13H,4-5,8-9H2/t10-,12+,13+/m1/s1 |
| InChIKey | RUNGOOPOHAMGNQ-WXHSDQCUSA-N |
| XLogP | 1.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|