C15H12F2O3S — CID 11370314
2-(2,4-difluorophenyl)-1-(4-methylsulfonylphenyl)ethanone (PubChem CID 11370314) has the molecular formula C15H12F2O3S and a molecular weight of 310.32 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-(4-methylsulfonylphenyl)ethanone.
| Compound Name | 2-(2,4-difluorophenyl)-1-(4-methylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 11370314 |
| Molecular Formula | C15H12F2O3S |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-(4-methylsulfonylphenyl)ethanone |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Cc2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C15H12F2O3S/c1-21(19,20)13-6-3-10(4-7-13)15(18)8-11-2-5-12(16)9-14(11)17/h2-7,9H,8H2,1H3 |
| InChIKey | HYOFHJBNYYKPGV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |