About methyl 3-(4-chlorophenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate
methyl 3-(4-chlorophenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate (PubChem CID 11370464) has the molecular formula C15H23ClO3Si
and a molecular weight of 314.89 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate.
Molecular Properties
| Compound Name | methyl 3-(4-chlorophenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate |
| PubChem CID | 11370464 |
| Molecular Formula | C15H23ClO3Si |
| Molecular Weight | 314.89 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | methyl 3-(4-chlorophenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate |
| SMILES | COC(=O)C(C)(C)C(O[Si](C)(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H23ClO3Si/c1-15(2,14(17)18-3)13(19-20(4,5)6)11-7-9-12(16)10-8-11/h7-10,13H,1-6H3 |
| InChIKey | CQPGMAIHWDQGPK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.89 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(4-chlorophenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(4-chlorophenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate?
The IUPAC name of methyl 3-(4-chlorophenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate (CID 11370464) is methyl 3-(4-chlorophenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate.
What is the SMILES notation for methyl 3-(4-chlorophenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate?
The canonical SMILES for methyl 3-(4-chlorophenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate is COC(=O)C(C)(C)C(O[Si](C)(C)C)c1ccc(Cl)cc1.
What is the InChIKey of methyl 3-(4-chlorophenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate?
The InChIKey is CQPGMAIHWDQGPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23ClO3Si/c1-15(2,14(17)18-3)13(19-20(4,5)6)11-7-9-12(16)10-8-11/h7-10,13H,1-6H3.
What are the key properties of methyl 3-(4-chlorophenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate?
methyl 3-(4-chlorophenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate has a molecular weight of 314.89 g/mol, XLogP of 4.43, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-chlorophenyl)-2,2-dimethyl-3-trimethylsilyloxypropanoate is sourced from PubChem (CID 11370464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).