C17H22O6 — CID 11370682
ethyl 2-[(2R,4aR,6S,7R,8aS)-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]acetate (PubChem CID 11370682) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is ethyl 2-[(2R,4aR,6S,7R,8aS)-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]acetate.
| Compound Name | ethyl 2-[(2R,4aR,6S,7R,8aS)-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]acetate |
|---|---|
| PubChem CID | 11370682 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | ethyl 2-[(2R,4aR,6S,7R,8aS)-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C17H22O6/c1-2-20-16(19)9-13-12(18)8-14-15(22-13)10-21-17(23-14)11-6-4-3-5-7-11/h3-7,12-15,17-18H,2,8-10H2,1H3/t12-,13+,14+,15-,17-/m1/s1 |
| InChIKey | JGBPWHLVMOSXAW-RUCLQGLUSA-N |
| XLogP | 1.57 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |