About 6-cyclohexyl-5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid
6-cyclohexyl-5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid (PubChem CID 11370785) has the molecular formula C19H19NO2S
and a molecular weight of 325.43 g/mol. Its IUPAC name is 6-cyclohexyl-5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-cyclohexyl-5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid |
| PubChem CID | 11370785 |
| Molecular Formula | C19H19NO2S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 6-cyclohexyl-5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2[nH]c(-c3ccccc3)c(C3CCCCC3)c2s1 |
| InChI | InChI=1S/C19H19NO2S/c21-19(22)15-11-14-18(23-15)16(12-7-3-1-4-8-12)17(20-14)13-9-5-2-6-10-13/h2,5-6,9-12,20H,1,3-4,7-8H2,(H,21,22) |
| InChIKey | KWJJDJJGUBFGKF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-cyclohexyl-5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohexyl-5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid?
The IUPAC name of 6-cyclohexyl-5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid (CID 11370785) is 6-cyclohexyl-5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid.
What is the SMILES notation for 6-cyclohexyl-5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid?
The canonical SMILES for 6-cyclohexyl-5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid is O=C(O)c1cc2[nH]c(-c3ccccc3)c(C3CCCCC3)c2s1.
What is the InChIKey of 6-cyclohexyl-5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid?
The InChIKey is KWJJDJJGUBFGKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO2S/c21-19(22)15-11-14-18(23-15)16(12-7-3-1-4-8-12)17(20-14)13-9-5-2-6-10-13/h2,5-6,9-12,20H,1,3-4,7-8H2,(H,21,22).
What are the key properties of 6-cyclohexyl-5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid?
6-cyclohexyl-5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid has a molecular weight of 325.43 g/mol, XLogP of 5.64, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohexyl-5-phenyl-4H-thieno[3,2-b]pyrrole-2-carboxylic acid is sourced from PubChem (CID 11370785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).