About ditert-butyl-[1-(2,4,6-trimethylphenyl)imidazol-2-yl]phosphane
ditert-butyl-[1-(2,4,6-trimethylphenyl)imidazol-2-yl]phosphane (PubChem CID 11370929) has the molecular formula C20H31N2P
and a molecular weight of 330.46 g/mol. Its IUPAC name is ditert-butyl-[1-(2,4,6-trimethylphenyl)imidazol-2-yl]phosphane.
Molecular Properties
| Compound Name | ditert-butyl-[1-(2,4,6-trimethylphenyl)imidazol-2-yl]phosphane |
| PubChem CID | 11370929 |
| Molecular Formula | C20H31N2P |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | ditert-butyl-[1-(2,4,6-trimethylphenyl)imidazol-2-yl]phosphane |
| SMILES | Cc1cc(C)c(-n2ccnc2P(C(C)(C)C)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C20H31N2P/c1-14-12-15(2)17(16(3)13-14)22-11-10-21-18(22)23(19(4,5)6)20(7,8)9/h10-13H,1-9H3 |
| InChIKey | KPVSJXJPQXJIGQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl-[1-(2,4,6-trimethylphenyl)imidazol-2-yl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl-[1-(2,4,6-trimethylphenyl)imidazol-2-yl]phosphane?
The IUPAC name of ditert-butyl-[1-(2,4,6-trimethylphenyl)imidazol-2-yl]phosphane (CID 11370929) is ditert-butyl-[1-(2,4,6-trimethylphenyl)imidazol-2-yl]phosphane.
What is the SMILES notation for ditert-butyl-[1-(2,4,6-trimethylphenyl)imidazol-2-yl]phosphane?
The canonical SMILES for ditert-butyl-[1-(2,4,6-trimethylphenyl)imidazol-2-yl]phosphane is Cc1cc(C)c(-n2ccnc2P(C(C)(C)C)C(C)(C)C)c(C)c1.
What is the InChIKey of ditert-butyl-[1-(2,4,6-trimethylphenyl)imidazol-2-yl]phosphane?
The InChIKey is KPVSJXJPQXJIGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N2P/c1-14-12-15(2)17(16(3)13-14)22-11-10-21-18(22)23(19(4,5)6)20(7,8)9/h10-13H,1-9H3.
What are the key properties of ditert-butyl-[1-(2,4,6-trimethylphenyl)imidazol-2-yl]phosphane?
ditert-butyl-[1-(2,4,6-trimethylphenyl)imidazol-2-yl]phosphane has a molecular weight of 330.46 g/mol, XLogP of 5.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl-[1-(2,4,6-trimethylphenyl)imidazol-2-yl]phosphane is sourced from PubChem (CID 11370929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).