C19H16N4O2 — CID 11370982
5-[[6-(3-aminophenyl)furo[2,3-d]pyrimidin-4-yl]amino]-2-methylphenol (PubChem CID 11370982) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 5-[[6-(3-aminophenyl)furo[2,3-d]pyrimidin-4-yl]amino]-2-methylphenol.
| Compound Name | 5-[[6-(3-aminophenyl)furo[2,3-d]pyrimidin-4-yl]amino]-2-methylphenol |
|---|---|
| PubChem CID | 11370982 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 5-[[6-(3-aminophenyl)furo[2,3-d]pyrimidin-4-yl]amino]-2-methylphenol |
| SMILES | Cc1ccc(Nc2ncnc3oc(-c4cccc(N)c4)cc23)cc1O |
| InChI | InChI=1S/C19H16N4O2/c1-11-5-6-14(8-16(11)24)23-18-15-9-17(25-19(15)22-10-21-18)12-3-2-4-13(20)7-12/h2-10,24H,20H2,1H3,(H,21,22,23) |
| InChIKey | QROLHGWWFRPOAP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|