C10H15F3O7S — CID 11371090
[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl trifluoromethanesulfonate (PubChem CID 11371090) has the molecular formula C10H15F3O7S and a molecular weight of 336.28 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11371090 |
| Molecular Formula | C10H15F3O7S |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl trifluoromethanesulfonate |
| SMILES | CO[C@@H]1O[C@H](COS(=O)(=O)C(F)(F)F)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C10H15F3O7S/c1-9(2)19-6-5(18-8(16-3)7(6)20-9)4-17-21(14,15)10(11,12)13/h5-8H,4H2,1-3H3/t5-,6-,7-,8-/m1/s1 |
| InChIKey | WMVLHICHFPNQAM-WCTZXXKLSA-N |
| XLogP | 0.74 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|