C19H36O3Si — CID 11371231
(4R)-4-methyl-5-[(2R,6R)-6-(2-triethylsilyloxyethyl)-3,6-dihydro-2H-pyran-2-yl]pentan-2-one (PubChem CID 11371231) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is (4R)-4-methyl-5-[(2R,6R)-6-(2-triethylsilyloxyethyl)-3,6-dihydro-2H-pyran-2-yl]pentan-2-one.
| Compound Name | (4R)-4-methyl-5-[(2R,6R)-6-(2-triethylsilyloxyethyl)-3,6-dihydro-2H-pyran-2-yl]pentan-2-one |
|---|---|
| PubChem CID | 11371231 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (4R)-4-methyl-5-[(2R,6R)-6-(2-triethylsilyloxyethyl)-3,6-dihydro-2H-pyran-2-yl]pentan-2-one |
| SMILES | CC[Si](CC)(CC)OCC[C@@H]1C=CC[C@@H](C[C@@H](C)CC(C)=O)O1 |
| InChI | InChI=1S/C19H36O3Si/c1-6-23(7-2,8-3)21-13-12-18-10-9-11-19(22-18)15-16(4)14-17(5)20/h9-10,16,18-19H,6-8,11-15H2,1-5H3/t16-,18-,19-/m0/s1 |
| InChIKey | SCOGYTTVADKCSX-WDSOQIARSA-N |
| XLogP | 5.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|