C18H12F2N2O3 — CID 11371273
7-fluoro-4-(4-fluorophenyl)-10-methyl-5H-furo[3,4-b][1,4]benzodiazepine-1,3-dione (PubChem CID 11371273) has the molecular formula C18H12F2N2O3 and a molecular weight of 342.30 g/mol. Its IUPAC name is 7-fluoro-4-(4-fluorophenyl)-10-methyl-5H-furo[3,4-b][1,4]benzodiazepine-1,3-dione.
| Compound Name | 7-fluoro-4-(4-fluorophenyl)-10-methyl-5H-furo[3,4-b][1,4]benzodiazepine-1,3-dione |
|---|---|
| PubChem CID | 11371273 |
| Molecular Formula | C18H12F2N2O3 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 7-fluoro-4-(4-fluorophenyl)-10-methyl-5H-furo[3,4-b][1,4]benzodiazepine-1,3-dione |
| SMILES | CN1C2=C(C(=O)OC2=O)N(c2ccc(F)cc2)Cc2cc(F)ccc21 |
| InChI | InChI=1S/C18H12F2N2O3/c1-21-14-7-4-12(20)8-10(14)9-22(13-5-2-11(19)3-6-13)16-15(21)17(23)25-18(16)24/h2-8H,9H2,1H3 |
| InChIKey | YSKWPGYJLHQGSN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|