C21H18N4O — CID 11371280
2-[3-cyano-5,5-dimethyl-4-[(1E,3E)-5-(1-methyl-4-pyridinylidene)penta-1,3-dienyl]furan-2-ylidene]propanedinitrile (PubChem CID 11371280) has the molecular formula C21H18N4O and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[3-cyano-5,5-dimethyl-4-[(1E,3E)-5-(1-methyl-4-pyridinylidene)penta-1,3-dienyl]furan-2-ylidene]propanedinitrile.
| Compound Name | 2-[3-cyano-5,5-dimethyl-4-[(1E,3E)-5-(1-methyl-4-pyridinylidene)penta-1,3-dienyl]furan-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 11371280 |
| Molecular Formula | C21H18N4O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-[3-cyano-5,5-dimethyl-4-[(1E,3E)-5-(1-methyl-4-pyridinylidene)penta-1,3-dienyl]furan-2-ylidene]propanedinitrile |
| SMILES | CN1C=CC(=C/C=C/C=C/C2=C(C#N)C(=C(C#N)C#N)OC2(C)C)C=C1 |
| InChI | InChI=1S/C21H18N4O/c1-21(2)19(18(15-24)20(26-21)17(13-22)14-23)8-6-4-5-7-16-9-11-25(3)12-10-16/h4-12H,1-3H3/b5-4+,8-6+ |
| InChIKey | GHRVZKZJPNAAQL-DVBIZMGNSA-N |
| XLogP | 3.93 |
| TPSA | 83.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|