C19H34O4Si — CID 11371667
ethyl 2-[(1R,2S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-6-prop-2-enylcyclohex-3-en-1-yl]acetate (PubChem CID 11371667) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is ethyl 2-[(1R,2S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-6-prop-2-enylcyclohex-3-en-1-yl]acetate.
| Compound Name | ethyl 2-[(1R,2S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-6-prop-2-enylcyclohex-3-en-1-yl]acetate |
|---|---|
| PubChem CID | 11371667 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | ethyl 2-[(1R,2S,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-6-prop-2-enylcyclohex-3-en-1-yl]acetate |
| SMILES | C=CC[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)C=CC(O)[C@@H]1CC(=O)OCC |
| InChI | InChI=1S/C19H34O4Si/c1-8-10-14-15(13-18(21)22-9-2)16(20)11-12-17(14)23-24(6,7)19(3,4)5/h8,11-12,14-17,20H,1,9-10,13H2,2-7H3/t14-,15-,16?,17-/m1/s1 |
| InChIKey | DVKPXIAPJZGECJ-FRBBGCKASA-N |
| XLogP | 4.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|