C24H15N3O — CID 11371867
4-(2-oxo-3-quinolin-2-yl-1,3-dihydroindol-5-yl)benzonitrile (PubChem CID 11371867) has the molecular formula C24H15N3O and a molecular weight of 361.40 g/mol. Its IUPAC name is 4-(2-oxo-3-quinolin-2-yl-1,3-dihydroindol-5-yl)benzonitrile.
| Compound Name | 4-(2-oxo-3-quinolin-2-yl-1,3-dihydroindol-5-yl)benzonitrile |
|---|---|
| PubChem CID | 11371867 |
| Molecular Formula | C24H15N3O |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 4-(2-oxo-3-quinolin-2-yl-1,3-dihydroindol-5-yl)benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(c2)C(c2ccc4ccccc4n2)C(=O)N3)cc1 |
| InChI | InChI=1S/C24H15N3O/c25-14-15-5-7-16(8-6-15)18-10-11-21-19(13-18)23(24(28)27-21)22-12-9-17-3-1-2-4-20(17)26-22/h1-13,23H,(H,27,28) |
| InChIKey | QRTWABXAQXFPTE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |