C25H34O2 — CID 11372023
(3R,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-3-phenyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 11372023) has the molecular formula C25H34O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is (3R,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-3-phenyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-3-phenyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 11372023 |
| Molecular Formula | C25H34O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (3R,8R,9S,10S,13S,14S)-3-hydroxy-10,13-dimethyl-3-phenyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@](O)(c3ccccc3)CC1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C25H34O2/c1-23-14-15-25(27,17-6-4-3-5-7-17)16-18(23)8-9-19-20-10-11-22(26)24(20,2)13-12-21(19)23/h3-7,18-21,27H,8-16H2,1-2H3/t18?,19-,20-,21-,23-,24-,25+/m0/s1 |
| InChIKey | FBCINCBIRWVDGR-VOTDOTPFSA-N |
| XLogP | 5.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |