C20H38O4Si — CID 11372151
methyl (2E,5S,6R,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,6,8-trimethyldeca-2,8-dienoate (PubChem CID 11372151) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is methyl (2E,5S,6R,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,6,8-trimethyldeca-2,8-dienoate.
| Compound Name | methyl (2E,5S,6R,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,6,8-trimethyldeca-2,8-dienoate |
|---|---|
| PubChem CID | 11372151 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | methyl (2E,5S,6R,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2,6,8-trimethyldeca-2,8-dienoate |
| SMILES | C/C=C(\C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](O)C/C=C(\C)C(=O)OC |
| InChI | InChI=1S/C20H38O4Si/c1-11-14(2)18(24-25(9,10)20(5,6)7)16(4)17(21)13-12-15(3)19(22)23-8/h11-12,16-18,21H,13H2,1-10H3/b14-11+,15-12+/t16-,17+,18-/m1/s1 |
| InChIKey | XBNUYTYVDUHMLO-KMNOQBFFSA-N |
| XLogP | 4.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|