C21H20N6O — CID 11372188
9-(1H-imidazol-2-ylmethoxy)-6-phenyl-4,5,7,8-tetrazatetracyclo[9.2.2.02,10.03,7]pentadeca-2(10),3,5,8-tetraene (PubChem CID 11372188) has the molecular formula C21H20N6O and a molecular weight of 372.43 g/mol. Its IUPAC name is 9-(1H-imidazol-2-ylmethoxy)-6-phenyl-4,5,7,8-tetrazatetracyclo[9.2.2.02,10.03,7]pentadeca-2(10),3,5,8-tetraene.
| Compound Name | 9-(1H-imidazol-2-ylmethoxy)-6-phenyl-4,5,7,8-tetrazatetracyclo[9.2.2.02,10.03,7]pentadeca-2(10),3,5,8-tetraene |
|---|---|
| PubChem CID | 11372188 |
| Molecular Formula | C21H20N6O |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 9-(1H-imidazol-2-ylmethoxy)-6-phenyl-4,5,7,8-tetrazatetracyclo[9.2.2.02,10.03,7]pentadeca-2(10),3,5,8-tetraene |
| SMILES | c1ccc(-c2nnc3c4c(c(OCc5ncc[nH]5)nn23)C2CCC4CC2)cc1 |
| InChI | InChI=1S/C21H20N6O/c1-2-4-15(5-3-1)19-24-25-20-17-13-6-8-14(9-7-13)18(17)21(26-27(19)20)28-12-16-22-10-11-23-16/h1-5,10-11,13-14H,6-9,12H2,(H,22,23) |
| InChIKey | IPEQYLWHCRAOTC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |