C17H29N7O3 — CID 11372389
N-[[(5R)-16-(dimethylamino)-4-oxo-2,3,15,17,18-pentazabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-5-yl]methyl]-N-hydroxyformamide (PubChem CID 11372389) has the molecular formula C17H29N7O3 and a molecular weight of 379.47 g/mol. Its IUPAC name is N-[[(5R)-16-(dimethylamino)-4-oxo-2,3,15,17,18-pentazabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-5-yl]methyl]-N-hydroxyformamide.
| Compound Name | N-[[(5R)-16-(dimethylamino)-4-oxo-2,3,15,17,18-pentazabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-5-yl]methyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 11372389 |
| Molecular Formula | C17H29N7O3 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | N-[[(5R)-16-(dimethylamino)-4-oxo-2,3,15,17,18-pentazabicyclo[12.3.1]octadeca-1(17),14(18),15-trien-5-yl]methyl]-N-hydroxyformamide |
| SMILES | CN(C)c1nc2nc(n1)NNC(=O)[C@@H](CN(O)C=O)CCCCCCCC2 |
| InChI | InChI=1S/C17H29N7O3/c1-23(2)17-19-14-10-8-6-4-3-5-7-9-13(11-24(27)12-25)15(26)21-22-16(18-14)20-17/h12-13,27H,3-11H2,1-2H3,(H,21,26)(H,18,19,20,22)/t13-/m1/s1 |
| InChIKey | IHLQRVXOFATCNA-CYBMUJFWSA-N |
| XLogP | 1.13 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|