C24H28O2S — CID 11372430
2-methyl-4-[(E)-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoic acid (PubChem CID 11372430) has the molecular formula C24H28O2S and a molecular weight of 380.55 g/mol. Its IUPAC name is 2-methyl-4-[(E)-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoic acid.
| Compound Name | 2-methyl-4-[(E)-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 11372430 |
| Molecular Formula | C24H28O2S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 2-methyl-4-[(E)-2-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)prop-1-enyl]benzoic acid |
| SMILES | C/C(=C\c1ccc(C(=O)O)c(C)c1)c1ccc2c(c1)C(C)(C)CC(C)(C)S2 |
| InChI | InChI=1S/C24H28O2S/c1-15(11-17-7-9-19(22(25)26)16(2)12-17)18-8-10-21-20(13-18)23(3,4)14-24(5,6)27-21/h7-13H,14H2,1-6H3,(H,25,26)/b15-11+ |
| InChIKey | LVNNQQUEBWKWOI-RVDMUPIBSA-N |
| XLogP | 6.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|