C20H36O5Si — CID 11372550
(2S)-6-(1,3-dioxolan-2-ylmethyl)-2-[2-tri(propan-2-yl)silyloxyethyl]-2,3-dihydropyran-4-one (PubChem CID 11372550) has the molecular formula C20H36O5Si and a molecular weight of 384.59 g/mol. Its IUPAC name is (2S)-6-(1,3-dioxolan-2-ylmethyl)-2-[2-tri(propan-2-yl)silyloxyethyl]-2,3-dihydropyran-4-one.
| Compound Name | (2S)-6-(1,3-dioxolan-2-ylmethyl)-2-[2-tri(propan-2-yl)silyloxyethyl]-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 11372550 |
| Molecular Formula | C20H36O5Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (2S)-6-(1,3-dioxolan-2-ylmethyl)-2-[2-tri(propan-2-yl)silyloxyethyl]-2,3-dihydropyran-4-one |
| SMILES | CC(C)[Si](OCC[C@H]1CC(=O)C=C(CC2OCCO2)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H36O5Si/c1-14(2)26(15(3)4,16(5)6)24-8-7-18-11-17(21)12-19(25-18)13-20-22-9-10-23-20/h12,14-16,18,20H,7-11,13H2,1-6H3/t18-/m0/s1 |
| InChIKey | XWWTYWUXINPCAF-SFHVURJKSA-N |
| XLogP | 4.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|