C21H42O4Si — CID 11372598
(3S,4S,5S)-2-ethoxy-5-(methoxymethoxy)-4-[(E)-2-methyl-3-trimethylsilylprop-2-enyl]dec-1-en-3-ol (PubChem CID 11372598) has the molecular formula C21H42O4Si and a molecular weight of 386.65 g/mol. Its IUPAC name is (3S,4S,5S)-2-ethoxy-5-(methoxymethoxy)-4-[(E)-2-methyl-3-trimethylsilylprop-2-enyl]dec-1-en-3-ol.
| Compound Name | (3S,4S,5S)-2-ethoxy-5-(methoxymethoxy)-4-[(E)-2-methyl-3-trimethylsilylprop-2-enyl]dec-1-en-3-ol |
|---|---|
| PubChem CID | 11372598 |
| Molecular Formula | C21H42O4Si |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | (3S,4S,5S)-2-ethoxy-5-(methoxymethoxy)-4-[(E)-2-methyl-3-trimethylsilylprop-2-enyl]dec-1-en-3-ol |
| SMILES | C=C(OCC)[C@@H](O)[C@H](C/C(C)=C/[Si](C)(C)C)[C@H](CCCCC)OCOC |
| InChI | InChI=1S/C21H42O4Si/c1-9-11-12-13-20(25-16-23-5)19(21(22)18(4)24-10-2)14-17(3)15-26(6,7)8/h15,19-22H,4,9-14,16H2,1-3,5-8H3/b17-15+/t19-,20+,21-/m1/s1 |
| InChIKey | PKCQZISPMSYRPM-FENYIOJPSA-N |
| XLogP | 5.30 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|