C18H15BrN2O3 — CID 11372607
1-[(5-bromo-2-phenylmethoxyphenyl)methyl]pyrazole-3-carboxylic acid (PubChem CID 11372607) has the molecular formula C18H15BrN2O3 and a molecular weight of 387.23 g/mol. Its IUPAC name is 1-[(5-bromo-2-phenylmethoxyphenyl)methyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[(5-bromo-2-phenylmethoxyphenyl)methyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 11372607 |
| Molecular Formula | C18H15BrN2O3 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 1-[(5-bromo-2-phenylmethoxyphenyl)methyl]pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1ccn(Cc2cc(Br)ccc2OCc2ccccc2)n1 |
| InChI | InChI=1S/C18H15BrN2O3/c19-15-6-7-17(24-12-13-4-2-1-3-5-13)14(10-15)11-21-9-8-16(20-21)18(22)23/h1-10H,11-12H2,(H,22,23) |
| InChIKey | ARWLUHPEWVBTRJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |