C20H24Cl2N4 — CID 11372742
5-(3,5-dichlorophenyl)-2-(4-piperidin-1-ylpiperidin-1-yl)pyrimidine (PubChem CID 11372742) has the molecular formula C20H24Cl2N4 and a molecular weight of 391.35 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)-2-(4-piperidin-1-ylpiperidin-1-yl)pyrimidine.
| Compound Name | 5-(3,5-dichlorophenyl)-2-(4-piperidin-1-ylpiperidin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 11372742 |
| Molecular Formula | C20H24Cl2N4 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 5-(3,5-dichlorophenyl)-2-(4-piperidin-1-ylpiperidin-1-yl)pyrimidine |
| SMILES | Clc1cc(Cl)cc(-c2cnc(N3CCC(N4CCCCC4)CC3)nc2)c1 |
| InChI | InChI=1S/C20H24Cl2N4/c21-17-10-15(11-18(22)12-17)16-13-23-20(24-14-16)26-8-4-19(5-9-26)25-6-2-1-3-7-25/h10-14,19H,1-9H2 |
| InChIKey | IQIMMBLXSWEOAT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |