C20H27NO5S — CID 11372800
[(8R,9S,13S,14S)-2-ethoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate (PubChem CID 11372800) has the molecular formula C20H27NO5S and a molecular weight of 393.51 g/mol. Its IUPAC name is [(8R,9S,13S,14S)-2-ethoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate.
| Compound Name | [(8R,9S,13S,14S)-2-ethoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate |
|---|---|
| PubChem CID | 11372800 |
| Molecular Formula | C20H27NO5S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | [(8R,9S,13S,14S)-2-ethoxy-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate |
| SMILES | CCOc1cc2c(cc1OS(N)(=O)=O)CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C20H27NO5S/c1-3-25-17-11-15-12(10-18(17)26-27(21,23)24)4-5-14-13(15)8-9-20(2)16(14)6-7-19(20)22/h10-11,13-14,16H,3-9H2,1-2H3,(H2,21,23,24)/t13-,14+,16-,20-/m0/s1 |
| InChIKey | KLUBMCIEPHWLGE-IDLUEMFASA-N |
| XLogP | 3.09 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |