C22H31N3O4 — CID 11372999
trans-(1S,2S)-N-hydroxy-5-[(3R)-3-hydroxypyrrolidin-1-yl]-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]cyclohexane-1-carboxamide (PubChem CID 11372999) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is trans-(1S,2S)-N-hydroxy-5-[(3R)-3-hydroxypyrrolidin-1-yl]-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]cyclohexane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-hydroxy-5-[(3R)-3-hydroxypyrrolidin-1-yl]-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 11372999 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | trans-(1S,2S)-N-hydroxy-5-[(3R)-3-hydroxypyrrolidin-1-yl]-2-[(3R)-3-phenylpyrrolidine-1-carbonyl]cyclohexane-1-carboxamide |
| SMILES | O=C(NO)[C@H]1CC(N2CC[C@@H](O)C2)CC[C@@H]1C(=O)N1CC[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C22H31N3O4/c26-18-9-11-24(14-18)17-6-7-19(20(12-17)21(27)23-29)22(28)25-10-8-16(13-25)15-4-2-1-3-5-15/h1-5,16-20,26,29H,6-14H2,(H,23,27)/t16-,17?,18+,19-,20-/m0/s1 |
| InChIKey | SHXQNRYJPPZXIO-LFAANDJTSA-N |
| XLogP | 1.36 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|