C21H17F3N2OS — CID 11373021
2-[(2-fluorophenyl)-bis(4-fluorophenyl)methyl]sulfanyl-N'-hydroxyethanimidamide (PubChem CID 11373021) has the molecular formula C21H17F3N2OS and a molecular weight of 402.44 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)-bis(4-fluorophenyl)methyl]sulfanyl-N'-hydroxyethanimidamide.
| Compound Name | 2-[(2-fluorophenyl)-bis(4-fluorophenyl)methyl]sulfanyl-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 11373021 |
| Molecular Formula | C21H17F3N2OS |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 2-[(2-fluorophenyl)-bis(4-fluorophenyl)methyl]sulfanyl-N'-hydroxyethanimidamide |
| SMILES | N/C(CSC(c1ccc(F)cc1)(c1ccc(F)cc1)c1ccccc1F)=N/O |
| InChI | InChI=1S/C21H17F3N2OS/c22-16-9-5-14(6-10-16)21(28-13-20(25)26-27,15-7-11-17(23)12-8-15)18-3-1-2-4-19(18)24/h1-12,27H,13H2,(H2,25,26) |
| InChIKey | BPJRZPBLXUVFOJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|