About ethyl 4-(4-bromophenyl)-2-(2,6-difluorophenyl)-4,5-dihydroimidazole-1-carboxylate
ethyl 4-(4-bromophenyl)-2-(2,6-difluorophenyl)-4,5-dihydroimidazole-1-carboxylate (PubChem CID 11373200) has the molecular formula C18H15BrF2N2O2
and a molecular weight of 409.23 g/mol. Its IUPAC name is ethyl 4-(4-bromophenyl)-2-(2,6-difluorophenyl)-4,5-dihydroimidazole-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(4-bromophenyl)-2-(2,6-difluorophenyl)-4,5-dihydroimidazole-1-carboxylate |
| PubChem CID | 11373200 |
| Molecular Formula | C18H15BrF2N2O2 |
| Molecular Weight | 409.23 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | ethyl 4-(4-bromophenyl)-2-(2,6-difluorophenyl)-4,5-dihydroimidazole-1-carboxylate |
| SMILES | CCOC(=O)N1CC(c2ccc(Br)cc2)N=C1c1c(F)cccc1F |
| InChI | InChI=1S/C18H15BrF2N2O2/c1-2-25-18(24)23-10-15(11-6-8-12(19)9-7-11)22-17(23)16-13(20)4-3-5-14(16)21/h3-9,15H,2,10H2,1H3 |
| InChIKey | GIOUIIHADAEHQP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.23 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-(4-bromophenyl)-2-(2,6-difluorophenyl)-4,5-dihydroimidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(4-bromophenyl)-2-(2,6-difluorophenyl)-4,5-dihydroimidazole-1-carboxylate?
The IUPAC name of ethyl 4-(4-bromophenyl)-2-(2,6-difluorophenyl)-4,5-dihydroimidazole-1-carboxylate (CID 11373200) is ethyl 4-(4-bromophenyl)-2-(2,6-difluorophenyl)-4,5-dihydroimidazole-1-carboxylate.
What is the SMILES notation for ethyl 4-(4-bromophenyl)-2-(2,6-difluorophenyl)-4,5-dihydroimidazole-1-carboxylate?
The canonical SMILES for ethyl 4-(4-bromophenyl)-2-(2,6-difluorophenyl)-4,5-dihydroimidazole-1-carboxylate is CCOC(=O)N1CC(c2ccc(Br)cc2)N=C1c1c(F)cccc1F.
What is the InChIKey of ethyl 4-(4-bromophenyl)-2-(2,6-difluorophenyl)-4,5-dihydroimidazole-1-carboxylate?
The InChIKey is GIOUIIHADAEHQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15BrF2N2O2/c1-2-25-18(24)23-10-15(11-6-8-12(19)9-7-11)22-17(23)16-13(20)4-3-5-14(16)21/h3-9,15H,2,10H2,1H3.
What are the key properties of ethyl 4-(4-bromophenyl)-2-(2,6-difluorophenyl)-4,5-dihydroimidazole-1-carboxylate?
ethyl 4-(4-bromophenyl)-2-(2,6-difluorophenyl)-4,5-dihydroimidazole-1-carboxylate has a molecular weight of 409.23 g/mol, XLogP of 4.69, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(4-bromophenyl)-2-(2,6-difluorophenyl)-4,5-dihydroimidazole-1-carboxylate is sourced from PubChem (CID 11373200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).