C23H19N5O3 — CID 11373312
N-(6-methoxy-12-oxo-9-phenyl-1,7,10-triazatricyclo[6.4.1.04,13]trideca-4,6,8(13),9-tetraen-11-yl)pyridine-3-carboxamide (PubChem CID 11373312) has the molecular formula C23H19N5O3 and a molecular weight of 413.44 g/mol. Its IUPAC name is N-(6-methoxy-12-oxo-9-phenyl-1,7,10-triazatricyclo[6.4.1.04,13]trideca-4,6,8(13),9-tetraen-11-yl)pyridine-3-carboxamide.
| Compound Name | N-(6-methoxy-12-oxo-9-phenyl-1,7,10-triazatricyclo[6.4.1.04,13]trideca-4,6,8(13),9-tetraen-11-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11373312 |
| Molecular Formula | C23H19N5O3 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-(6-methoxy-12-oxo-9-phenyl-1,7,10-triazatricyclo[6.4.1.04,13]trideca-4,6,8(13),9-tetraen-11-yl)pyridine-3-carboxamide |
| SMILES | COc1cc2c3c(n1)C(c1ccccc1)=NC(NC(=O)c1cccnc1)C(=O)N3CC2 |
| InChI | InChI=1S/C23H19N5O3/c1-31-17-12-15-9-11-28-20(15)19(25-17)18(14-6-3-2-4-7-14)26-21(23(28)30)27-22(29)16-8-5-10-24-13-16/h2-8,10,12-13,21H,9,11H2,1H3,(H,27,29) |
| InChIKey | MXUGSITVXIZQHM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 96.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |