About 2-[5-chloro-2-(4-chlorophenyl)-1H-indol-3-yl]-2-oxo-N,N-dipropylacetamide
2-[5-chloro-2-(4-chlorophenyl)-1H-indol-3-yl]-2-oxo-N,N-dipropylacetamide (PubChem CID 11373424) has the molecular formula C22H22Cl2N2O2
and a molecular weight of 417.34 g/mol. Its IUPAC name is 2-[5-chloro-2-(4-chlorophenyl)-1H-indol-3-yl]-2-oxo-N,N-dipropylacetamide.
Molecular Properties
| Compound Name | 2-[5-chloro-2-(4-chlorophenyl)-1H-indol-3-yl]-2-oxo-N,N-dipropylacetamide |
| PubChem CID | 11373424 |
| Molecular Formula | C22H22Cl2N2O2 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 2-[5-chloro-2-(4-chlorophenyl)-1H-indol-3-yl]-2-oxo-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)C(=O)c1c(-c2ccc(Cl)cc2)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C22H22Cl2N2O2/c1-3-11-26(12-4-2)22(28)21(27)19-17-13-16(24)9-10-18(17)25-20(19)14-5-7-15(23)8-6-14/h5-10,13,25H,3-4,11-12H2,1-2H3 |
| InChIKey | CZZNAZRFMIBLFO-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-chloro-2-(4-chlorophenyl)-1H-indol-3-yl]-2-oxo-N,N-dipropylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-chloro-2-(4-chlorophenyl)-1H-indol-3-yl]-2-oxo-N,N-dipropylacetamide?
The IUPAC name of 2-[5-chloro-2-(4-chlorophenyl)-1H-indol-3-yl]-2-oxo-N,N-dipropylacetamide (CID 11373424) is 2-[5-chloro-2-(4-chlorophenyl)-1H-indol-3-yl]-2-oxo-N,N-dipropylacetamide.
What is the SMILES notation for 2-[5-chloro-2-(4-chlorophenyl)-1H-indol-3-yl]-2-oxo-N,N-dipropylacetamide?
The canonical SMILES for 2-[5-chloro-2-(4-chlorophenyl)-1H-indol-3-yl]-2-oxo-N,N-dipropylacetamide is CCCN(CCC)C(=O)C(=O)c1c(-c2ccc(Cl)cc2)[nH]c2ccc(Cl)cc12.
What is the InChIKey of 2-[5-chloro-2-(4-chlorophenyl)-1H-indol-3-yl]-2-oxo-N,N-dipropylacetamide?
The InChIKey is CZZNAZRFMIBLFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22Cl2N2O2/c1-3-11-26(12-4-2)22(28)21(27)19-17-13-16(24)9-10-18(17)25-20(19)14-5-7-15(23)8-6-14/h5-10,13,25H,3-4,11-12H2,1-2H3.
What are the key properties of 2-[5-chloro-2-(4-chlorophenyl)-1H-indol-3-yl]-2-oxo-N,N-dipropylacetamide?
2-[5-chloro-2-(4-chlorophenyl)-1H-indol-3-yl]-2-oxo-N,N-dipropylacetamide has a molecular weight of 417.34 g/mol, XLogP of 5.97, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-chloro-2-(4-chlorophenyl)-1H-indol-3-yl]-2-oxo-N,N-dipropylacetamide is sourced from PubChem (CID 11373424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).