C29H37NO2 — CID 11373833
[(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-[(E)-2-phenylpent-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-phenylmethanone (PubChem CID 11373833) has the molecular formula C29H37NO2 and a molecular weight of 431.62 g/mol. Its IUPAC name is [(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-[(E)-2-phenylpent-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-phenylmethanone.
| Compound Name | [(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-[(E)-2-phenylpent-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 11373833 |
| Molecular Formula | C29H37NO2 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | [(2S,4aS,7R,8aR)-4,4,7-trimethyl-3-[(E)-2-phenylpent-2-enyl]-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazin-2-yl]-phenylmethanone |
| SMILES | CC/C=C(/CN1[C@H](C(=O)c2ccccc2)O[C@@H]2C[C@H](C)CC[C@H]2C1(C)C)c1ccccc1 |
| InChI | InChI=1S/C29H37NO2/c1-5-12-24(22-13-8-6-9-14-22)20-30-28(27(31)23-15-10-7-11-16-23)32-26-19-21(2)17-18-25(26)29(30,3)4/h6-16,21,25-26,28H,5,17-20H2,1-4H3/b24-12-/t21-,25-,26-,28+/m1/s1 |
| InChIKey | GQUBFQMGYKEZCN-XNKAZFJOSA-N |
| XLogP | 6.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |