C24H38O7 — CID 11374017
[(2S,3S,4E,6R)-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-(2-methyl-1-oxopropan-2-yl)-6-prop-2-enyloxan-3-yl] octanoate (PubChem CID 11374017) has the molecular formula C24H38O7 and a molecular weight of 438.56 g/mol. Its IUPAC name is [(2S,3S,4E,6R)-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-(2-methyl-1-oxopropan-2-yl)-6-prop-2-enyloxan-3-yl] octanoate.
| Compound Name | [(2S,3S,4E,6R)-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-(2-methyl-1-oxopropan-2-yl)-6-prop-2-enyloxan-3-yl] octanoate |
|---|---|
| PubChem CID | 11374017 |
| Molecular Formula | C24H38O7 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | [(2S,3S,4E,6R)-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-(2-methyl-1-oxopropan-2-yl)-6-prop-2-enyloxan-3-yl] octanoate |
| SMILES | C=CC[C@@H]1C/C(=C\C(=O)OC)[C@H](OC(=O)CCCCCCC)[C@](OC)(C(C)(C)C=O)O1 |
| InChI | InChI=1S/C24H38O7/c1-7-9-10-11-12-14-20(26)30-22-18(16-21(27)28-5)15-19(13-8-2)31-24(22,29-6)23(3,4)17-25/h8,16-17,19,22H,2,7,9-15H2,1,3-6H3/b18-16+/t19-,22+,24-/m1/s1 |
| InChIKey | YRHCBQSLPJAKGQ-FVXVEJJZSA-N |
| XLogP | 4.29 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|