C19H17IN2O3 — CID 11374276
(1S,18R)-15-[(Z)-2-iodobut-2-enyl]-10-oxa-8,15-diazapentacyclo[9.6.1.01,14.02,7.08,18]octadeca-2,4,6,13-tetraene-9,16-dione (PubChem CID 11374276) has the molecular formula C19H17IN2O3 and a molecular weight of 448.26 g/mol. Its IUPAC name is (1S,18R)-15-[(Z)-2-iodobut-2-enyl]-10-oxa-8,15-diazapentacyclo[9.6.1.01,14.02,7.08,18]octadeca-2,4,6,13-tetraene-9,16-dione.
| Compound Name | (1S,18R)-15-[(Z)-2-iodobut-2-enyl]-10-oxa-8,15-diazapentacyclo[9.6.1.01,14.02,7.08,18]octadeca-2,4,6,13-tetraene-9,16-dione |
|---|---|
| PubChem CID | 11374276 |
| Molecular Formula | C19H17IN2O3 |
| Molecular Weight | 448.26 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | (1S,18R)-15-[(Z)-2-iodobut-2-enyl]-10-oxa-8,15-diazapentacyclo[9.6.1.01,14.02,7.08,18]octadeca-2,4,6,13-tetraene-9,16-dione |
| SMILES | C/C=C(\I)CN1C(=O)C[C@]23C1=CCC1OC(=O)N(c4ccccc42)[C@@H]13 |
| InChI | InChI=1S/C19H17IN2O3/c1-2-11(20)10-21-15-8-7-14-17-19(15,9-16(21)23)12-5-3-4-6-13(12)22(17)18(24)25-14/h2-6,8,14,17H,7,9-10H2,1H3/b11-2-/t14?,17-,19+/m0/s1 |
| InChIKey | BGJCCYLPLJJUDY-RGPZPWEHSA-N |
| XLogP | 3.49 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|