C28H36O3Si — CID 11374293
(4R,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-[(2Z,5E)-octa-2,5-dienyl]oxolan-2-one (PubChem CID 11374293) has the molecular formula C28H36O3Si and a molecular weight of 448.68 g/mol. Its IUPAC name is (4R,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-[(2Z,5E)-octa-2,5-dienyl]oxolan-2-one.
| Compound Name | (4R,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-[(2Z,5E)-octa-2,5-dienyl]oxolan-2-one |
|---|---|
| PubChem CID | 11374293 |
| Molecular Formula | C28H36O3Si |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | (4R,5R)-4-[tert-butyl(diphenyl)silyl]oxy-5-[(2Z,5E)-octa-2,5-dienyl]oxolan-2-one |
| SMILES | CC/C=C/C/C=C\C[C@H]1OC(=O)C[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H36O3Si/c1-5-6-7-8-9-16-21-25-26(22-27(29)30-25)31-32(28(2,3)4,23-17-12-10-13-18-23)24-19-14-11-15-20-24/h6-7,9-20,25-26H,5,8,21-22H2,1-4H3/b7-6+,16-9-/t25-,26-/m1/s1 |
| InChIKey | GZVFENXLWDDTOY-FFVYWFHNSA-N |
| XLogP | 5.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|