C24H43NO3Si2 — CID 11374335
(2R,3S,4S)-N-benzyl-2-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-6-trimethylsilylhex-5-yn-3-amine (PubChem CID 11374335) has the molecular formula C24H43NO3Si2 and a molecular weight of 449.78 g/mol. Its IUPAC name is (2R,3S,4S)-N-benzyl-2-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-6-trimethylsilylhex-5-yn-3-amine.
| Compound Name | (2R,3S,4S)-N-benzyl-2-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-6-trimethylsilylhex-5-yn-3-amine |
|---|---|
| PubChem CID | 11374335 |
| Molecular Formula | C24H43NO3Si2 |
| Molecular Weight | 449.78 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | (2R,3S,4S)-N-benzyl-2-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-6-trimethylsilylhex-5-yn-3-amine |
| SMILES | COCO[C@@H](C#C[Si](C)(C)C)[C@H](NCc1ccccc1)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H43NO3Si2/c1-20(28-30(9,10)24(2,3)4)23(25-18-21-14-12-11-13-15-21)22(27-19-26-5)16-17-29(6,7)8/h11-15,20,22-23,25H,18-19H2,1-10H3/t20-,22+,23-/m1/s1 |
| InChIKey | RAACRLLTBONCNC-AKIFATBCSA-N |
| XLogP | 5.43 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.78 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|