C26H30N2O3S — CID 11374355
ethyl (5Z)-5-[(3aS,6aR)-1,3-dibenzyl-2-oxo-6,6a-dihydro-3aH-thieno[3,4-d]imidazol-4-ylidene]pentanoate (PubChem CID 11374355) has the molecular formula C26H30N2O3S and a molecular weight of 450.60 g/mol. Its IUPAC name is ethyl (5Z)-5-[(3aS,6aR)-1,3-dibenzyl-2-oxo-6,6a-dihydro-3aH-thieno[3,4-d]imidazol-4-ylidene]pentanoate.
| Compound Name | ethyl (5Z)-5-[(3aS,6aR)-1,3-dibenzyl-2-oxo-6,6a-dihydro-3aH-thieno[3,4-d]imidazol-4-ylidene]pentanoate |
|---|---|
| PubChem CID | 11374355 |
| Molecular Formula | C26H30N2O3S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | ethyl (5Z)-5-[(3aS,6aR)-1,3-dibenzyl-2-oxo-6,6a-dihydro-3aH-thieno[3,4-d]imidazol-4-ylidene]pentanoate |
| SMILES | CCOC(=O)CCC/C=C1\SC[C@H]2[C@@H]1N(Cc1ccccc1)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C26H30N2O3S/c1-2-31-24(29)16-10-9-15-23-25-22(19-32-23)27(17-20-11-5-3-6-12-20)26(30)28(25)18-21-13-7-4-8-14-21/h3-8,11-15,22,25H,2,9-10,16-19H2,1H3/b23-15-/t22-,25-/m0/s1 |
| InChIKey | XSOITXFENFDGIC-JSTAEBATSA-N |
| XLogP | 5.23 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|