C26H29F2N3O2 — CID 11374428
3-[cyclopropylmethyl-[4-(5-fluoro-1H-indol-3-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide (PubChem CID 11374428) has the molecular formula C26H29F2N3O2 and a molecular weight of 453.53 g/mol. Its IUPAC name is 3-[cyclopropylmethyl-[4-(5-fluoro-1H-indol-3-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide.
| Compound Name | 3-[cyclopropylmethyl-[4-(5-fluoro-1H-indol-3-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide |
|---|---|
| PubChem CID | 11374428 |
| Molecular Formula | C26H29F2N3O2 |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 3-[cyclopropylmethyl-[4-(5-fluoro-1H-indol-3-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide |
| SMILES | NC(=O)c1ccc(F)c2c1CC(N(CCCCc1c[nH]c3ccc(F)cc13)CC1CC1)CO2 |
| InChI | InChI=1S/C26H29F2N3O2/c27-18-6-9-24-21(11-18)17(13-30-24)3-1-2-10-31(14-16-4-5-16)19-12-22-20(26(29)32)7-8-23(28)25(22)33-15-19/h6-9,11,13,16,19,30H,1-5,10,12,14-15H2,(H2,29,32) |
| InChIKey | LLOLAUBGIFBYRO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|