About 3-[(3,4-dimethoxyphenoxy)methyl]-1-(4-methylsulfonylphenyl)-5-phenylpyrazole
3-[(3,4-dimethoxyphenoxy)methyl]-1-(4-methylsulfonylphenyl)-5-phenylpyrazole (PubChem CID 11374699) has the molecular formula C25H24N2O5S
and a molecular weight of 464.54 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenoxy)methyl]-1-(4-methylsulfonylphenyl)-5-phenylpyrazole.
Molecular Properties
| Compound Name | 3-[(3,4-dimethoxyphenoxy)methyl]-1-(4-methylsulfonylphenyl)-5-phenylpyrazole |
| PubChem CID | 11374699 |
| Molecular Formula | C25H24N2O5S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 3-[(3,4-dimethoxyphenoxy)methyl]-1-(4-methylsulfonylphenyl)-5-phenylpyrazole |
| SMILES | COc1ccc(OCc2cc(-c3ccccc3)n(-c3ccc(S(C)(=O)=O)cc3)n2)cc1OC |
| InChI | InChI=1S/C25H24N2O5S/c1-30-24-14-11-21(16-25(24)31-2)32-17-19-15-23(18-7-5-4-6-8-18)27(26-19)20-9-12-22(13-10-20)33(3,28)29/h4-16H,17H2,1-3H3 |
| InChIKey | JRCSJLWBWPGQBW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[(3,4-dimethoxyphenoxy)methyl]-1-(4-methylsulfonylphenyl)-5-phenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,4-dimethoxyphenoxy)methyl]-1-(4-methylsulfonylphenyl)-5-phenylpyrazole?
The IUPAC name of 3-[(3,4-dimethoxyphenoxy)methyl]-1-(4-methylsulfonylphenyl)-5-phenylpyrazole (CID 11374699) is 3-[(3,4-dimethoxyphenoxy)methyl]-1-(4-methylsulfonylphenyl)-5-phenylpyrazole.
What is the SMILES notation for 3-[(3,4-dimethoxyphenoxy)methyl]-1-(4-methylsulfonylphenyl)-5-phenylpyrazole?
The canonical SMILES for 3-[(3,4-dimethoxyphenoxy)methyl]-1-(4-methylsulfonylphenyl)-5-phenylpyrazole is COc1ccc(OCc2cc(-c3ccccc3)n(-c3ccc(S(C)(=O)=O)cc3)n2)cc1OC.
What is the InChIKey of 3-[(3,4-dimethoxyphenoxy)methyl]-1-(4-methylsulfonylphenyl)-5-phenylpyrazole?
The InChIKey is JRCSJLWBWPGQBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N2O5S/c1-30-24-14-11-21(16-25(24)31-2)32-17-19-15-23(18-7-5-4-6-8-18)27(26-19)20-9-12-22(13-10-20)33(3,28)29/h4-16H,17H2,1-3H3.
What are the key properties of 3-[(3,4-dimethoxyphenoxy)methyl]-1-(4-methylsulfonylphenyl)-5-phenylpyrazole?
3-[(3,4-dimethoxyphenoxy)methyl]-1-(4-methylsulfonylphenyl)-5-phenylpyrazole has a molecular weight of 464.54 g/mol, XLogP of 4.54, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-dimethoxyphenoxy)methyl]-1-(4-methylsulfonylphenyl)-5-phenylpyrazole is sourced from PubChem (CID 11374699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).