C26H44O5Si — CID 11374703
methyl (E,7S,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-9-phenylmethoxydodec-5-enoate (PubChem CID 11374703) has the molecular formula C26H44O5Si and a molecular weight of 464.72 g/mol. Its IUPAC name is methyl (E,7S,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-9-phenylmethoxydodec-5-enoate.
| Compound Name | methyl (E,7S,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-9-phenylmethoxydodec-5-enoate |
|---|---|
| PubChem CID | 11374703 |
| Molecular Formula | C26H44O5Si |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | methyl (E,7S,8S,9R)-8-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-9-phenylmethoxydodec-5-enoate |
| SMILES | CCC[C@@H](OCc1ccccc1)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)/C=C/CCCC(=O)OC |
| InChI | InChI=1S/C26H44O5Si/c1-8-15-23(30-20-21-16-11-9-12-17-21)25(31-32(6,7)26(2,3)4)22(27)18-13-10-14-19-24(28)29-5/h9,11-13,16-18,22-23,25,27H,8,10,14-15,19-20H2,1-7H3/b18-13+/t22-,23+,25-/m0/s1 |
| InChIKey | ZQHMCRNGMWPGRJ-YIPXFULBSA-N |
| XLogP | 6.02 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|