C28H37NO7 — CID 11375467
tert-butyl (2S,3aR,4R,5R,6R)-4-(methoxymethoxy)-5-phenylmethoxy-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxylate (PubChem CID 11375467) has the molecular formula C28H37NO7 and a molecular weight of 499.60 g/mol. Its IUPAC name is tert-butyl (2S,3aR,4R,5R,6R)-4-(methoxymethoxy)-5-phenylmethoxy-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxylate.
| Compound Name | tert-butyl (2S,3aR,4R,5R,6R)-4-(methoxymethoxy)-5-phenylmethoxy-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxylate |
|---|---|
| PubChem CID | 11375467 |
| Molecular Formula | C28H37NO7 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | tert-butyl (2S,3aR,4R,5R,6R)-4-(methoxymethoxy)-5-phenylmethoxy-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxylate |
| SMILES | COCO[C@H]1[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)N2O[C@H](C(=O)OC(C)(C)C)C[C@H]12 |
| InChI | InChI=1S/C28H37NO7/c1-28(2,3)35-27(30)24-15-22-25(34-19-31-4)26(33-17-21-13-9-6-10-14-21)23(29(22)36-24)18-32-16-20-11-7-5-8-12-20/h5-14,22-26H,15-19H2,1-4H3/t22-,23-,24+,25-,26-/m1/s1 |
| InChIKey | OXYOGCLLOKTNCH-WSGIOKLISA-N |
| XLogP | 3.88 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|