C24H20ClNO7S — CID 11375499
2-[2-chloro-4-methylsulfonyl-3-[(3-phenyl-1,2-oxazol-5-yl)methoxy]benzoyl]cyclohexane-1,3-dione (PubChem CID 11375499) has the molecular formula C24H20ClNO7S and a molecular weight of 501.94 g/mol. Its IUPAC name is 2-[2-chloro-4-methylsulfonyl-3-[(3-phenyl-1,2-oxazol-5-yl)methoxy]benzoyl]cyclohexane-1,3-dione.
| Compound Name | 2-[2-chloro-4-methylsulfonyl-3-[(3-phenyl-1,2-oxazol-5-yl)methoxy]benzoyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 11375499 |
| Molecular Formula | C24H20ClNO7S |
| Molecular Weight | 501.94 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | 2-[2-chloro-4-methylsulfonyl-3-[(3-phenyl-1,2-oxazol-5-yl)methoxy]benzoyl]cyclohexane-1,3-dione |
| SMILES | CS(=O)(=O)c1ccc(C(=O)C2C(=O)CCCC2=O)c(Cl)c1OCc1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C24H20ClNO7S/c1-34(30,31)20-11-10-16(23(29)21-18(27)8-5-9-19(21)28)22(25)24(20)32-13-15-12-17(26-33-15)14-6-3-2-4-7-14/h2-4,6-7,10-12,21H,5,8-9,13H2,1H3 |
| InChIKey | ALTMGDCLSNYWQC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 120.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.94 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|