C23H41BN6O6 — CID 11375618
(2S)-2-acetamido-5-[[amino(nitramido)methylidene]amino]-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]pentanamide (PubChem CID 11375618) has the molecular formula C23H41BN6O6 and a molecular weight of 508.43 g/mol. Its IUPAC name is (2S)-2-acetamido-5-[[amino(nitramido)methylidene]amino]-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]pentanamide.
| Compound Name | (2S)-2-acetamido-5-[[amino(nitramido)methylidene]amino]-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]pentanamide |
|---|---|
| PubChem CID | 11375618 |
| Molecular Formula | C23H41BN6O6 |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 508.32 |
| IUPAC Name | (2S)-2-acetamido-5-[[amino(nitramido)methylidene]amino]-N-[(1R)-3-methyl-1-[(1R,2S,6R,8R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl]pentanamide |
| SMILES | CC(=O)N[C@@H](CCC/N=C(\N)N[N+](=O)[O-])C(=O)N[C@@H](CC(C)C)B1O[C@@H]2C[C@H]3C[C@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C23H41BN6O6/c1-13(2)10-19(24-35-18-12-15-11-17(22(15,4)5)23(18,6)36-24)28-20(32)16(27-14(3)31)8-7-9-26-21(25)29-30(33)34/h13,15-19H,7-12H2,1-6H3,(H,27,31)(H,28,32)(H3,25,26,29)/t15-,16+,17-,18-,19+,23+/m1/s1 |
| InChIKey | JVLMQPCVPXNBPG-DWELEQRGSA-N |
| XLogP | 1.17 |
| TPSA | 170.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|