C23H25F4N5S2 — CID 11375680
5-[5-[3-[(1S,5R)-1-[2-fluoro-4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-2,4-dimethyl-1,3-thiazole (PubChem CID 11375680) has the molecular formula C23H25F4N5S2 and a molecular weight of 511.61 g/mol. Its IUPAC name is 5-[5-[3-[(1S,5R)-1-[2-fluoro-4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-2,4-dimethyl-1,3-thiazole.
| Compound Name | 5-[5-[3-[(1S,5R)-1-[2-fluoro-4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-2,4-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 11375680 |
| Molecular Formula | C23H25F4N5S2 |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | 5-[5-[3-[(1S,5R)-1-[2-fluoro-4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-2,4-dimethyl-1,3-thiazole |
| SMILES | Cc1nc(C)c(-c2nnc(SCCCN3C[C@@H]4C[C@]4(c4ccc(C(F)(F)F)cc4F)C3)n2C)s1 |
| InChI | InChI=1S/C23H25F4N5S2/c1-13-19(34-14(2)28-13)20-29-30-21(31(20)3)33-8-4-7-32-11-16-10-22(16,12-32)17-6-5-15(9-18(17)24)23(25,26)27/h5-6,9,16H,4,7-8,10-12H2,1-3H3/t16-,22-/m0/s1 |
| InChIKey | CRZBMVVRCINCBG-AOMKIAJQSA-N |
| XLogP | 5.47 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|