C31H30O3P2 — CID 11375690
(1R,5S,6R,8S)-6,8-bis(diphenylphosphanyl)-3,9-dioxabicyclo[3.3.1]nonan-7-ol (PubChem CID 11375690) has the molecular formula C31H30O3P2 and a molecular weight of 512.53 g/mol. Its IUPAC name is (1R,5S,6R,8S)-6,8-bis(diphenylphosphanyl)-3,9-dioxabicyclo[3.3.1]nonan-7-ol.
| Compound Name | (1R,5S,6R,8S)-6,8-bis(diphenylphosphanyl)-3,9-dioxabicyclo[3.3.1]nonan-7-ol |
|---|---|
| PubChem CID | 11375690 |
| Molecular Formula | C31H30O3P2 |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | (1R,5S,6R,8S)-6,8-bis(diphenylphosphanyl)-3,9-dioxabicyclo[3.3.1]nonan-7-ol |
| SMILES | OC1[C@@H](P(c2ccccc2)c2ccccc2)[C@@H]2COC[C@@H](O2)[C@H]1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H30O3P2/c32-29-30(35(23-13-5-1-6-14-23)24-15-7-2-8-16-24)27-21-33-22-28(34-27)31(29)36(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20,27-32H,21-22H2/t27-,28+,29?,30-,31+ |
| InChIKey | RGHIUPFKMYTNLR-PWHCHMKRSA-N |
| XLogP | 4.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|