C27H52O5Si2 — CID 11375710
methyl (1E,5R,9S,10S,12R,13R)-5,9-dimethyl-3-oxo-12-propan-2-yl-10,13-bis(trimethylsilyloxy)cyclotetradecene-1-carboxylate (PubChem CID 11375710) has the molecular formula C27H52O5Si2 and a molecular weight of 512.88 g/mol. Its IUPAC name is methyl (1E,5R,9S,10S,12R,13R)-5,9-dimethyl-3-oxo-12-propan-2-yl-10,13-bis(trimethylsilyloxy)cyclotetradecene-1-carboxylate.
| Compound Name | methyl (1E,5R,9S,10S,12R,13R)-5,9-dimethyl-3-oxo-12-propan-2-yl-10,13-bis(trimethylsilyloxy)cyclotetradecene-1-carboxylate |
|---|---|
| PubChem CID | 11375710 |
| Molecular Formula | C27H52O5Si2 |
| Molecular Weight | 512.88 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | methyl (1E,5R,9S,10S,12R,13R)-5,9-dimethyl-3-oxo-12-propan-2-yl-10,13-bis(trimethylsilyloxy)cyclotetradecene-1-carboxylate |
| SMILES | COC(=O)/C1=C/C(=O)C[C@H](C)CCC[C@H](C)[C@@H](O[Si](C)(C)C)C[C@H](C(C)C)[C@H](O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C27H52O5Si2/c1-19(2)24-18-25(31-33(6,7)8)21(4)14-12-13-20(3)15-23(28)16-22(27(29)30-5)17-26(24)32-34(9,10)11/h16,19-21,24-26H,12-15,17-18H2,1-11H3/b22-16+/t20-,21+,24-,25+,26-/m1/s1 |
| InChIKey | JSSMLDWPXQWPMH-QUPIHMBASA-N |
| XLogP | 6.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.88 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|