C27H29F4N3O3 — CID 11375822
(2R)-2-[(2R,5R)-5-(2,3-dihydro-1H-inden-2-yl)-2-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-2-(4-fluorophenyl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 11375822) has the molecular formula C27H29F4N3O3 and a molecular weight of 519.54 g/mol. Its IUPAC name is (2R)-2-[(2R,5R)-5-(2,3-dihydro-1H-inden-2-yl)-2-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-2-(4-fluorophenyl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | (2R)-2-[(2R,5R)-5-(2,3-dihydro-1H-inden-2-yl)-2-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-2-(4-fluorophenyl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 11375822 |
| Molecular Formula | C27H29F4N3O3 |
| Molecular Weight | 519.54 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | (2R)-2-[(2R,5R)-5-(2,3-dihydro-1H-inden-2-yl)-2-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-2-(4-fluorophenyl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CC(C)C[C@@H]1C(=O)N[C@H](C2Cc3ccccc3C2)C(=O)N1[C@@H](C(=O)NCC(F)(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H29F4N3O3/c1-15(2)11-21-24(35)33-22(19-12-17-5-3-4-6-18(17)13-19)26(37)34(21)23(16-7-9-20(28)10-8-16)25(36)32-14-27(29,30)31/h3-10,15,19,21-23H,11-14H2,1-2H3,(H,32,36)(H,33,35)/t21-,22-,23-/m1/s1 |
| InChIKey | QYVKRAZJKPUUSE-DNVJHFABSA-N |
| XLogP | 3.70 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |