C30H48O6Si — CID 11376038
(1S,2E,5S,8E,10Z,14E,17S)-13-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-1,2-dihydroxyethyl]-3,11-dimethyl-19-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraen-7-one (PubChem CID 11376038) has the molecular formula C30H48O6Si and a molecular weight of 532.79 g/mol. Its IUPAC name is (1S,2E,5S,8E,10Z,14E,17S)-13-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-1,2-dihydroxyethyl]-3,11-dimethyl-19-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraen-7-one.
| Compound Name | (1S,2E,5S,8E,10Z,14E,17S)-13-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-1,2-dihydroxyethyl]-3,11-dimethyl-19-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraen-7-one |
|---|---|
| PubChem CID | 11376038 |
| Molecular Formula | C30H48O6Si |
| Molecular Weight | 532.79 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | (1S,2E,5S,8E,10Z,14E,17S)-13-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-1,2-dihydroxyethyl]-3,11-dimethyl-19-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraen-7-one |
| SMILES | C=C1C[C@@H]2C/C=C/C(O[Si](C)(C)C(C)(C)C)C/C(C)=C\C=C\C(=O)O[C@H]([C@H](O)CO)C/C(C)=C/[C@H](C1)O2 |
| InChI | InChI=1S/C30H48O6Si/c1-21-11-9-14-29(33)35-28(27(32)20-31)19-23(3)18-26-17-22(2)16-24(34-26)12-10-13-25(15-21)36-37(7,8)30(4,5)6/h9-11,13-14,18,24-28,31-32H,2,12,15-17,19-20H2,1,3-8H3/b13-10+,14-9+,21-11-,23-18+/t24-,25?,26-,27+,28-/m0/s1 |
| InChIKey | HTCYKXXHIKTGMB-AUFJHYBDSA-N |
| XLogP | 5.93 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.79 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|