C30H55NO4Si2 — CID 11376273
tert-butyl N-benzyl-N-[(2R,3S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]hex-5-en-2-yl]carbamate (PubChem CID 11376273) has the molecular formula C30H55NO4Si2 and a molecular weight of 549.95 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[(2R,3S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]hex-5-en-2-yl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[(2R,3S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]hex-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 11376273 |
| Molecular Formula | C30H55NO4Si2 |
| Molecular Weight | 549.95 g/mol |
| Exact Mass | 549.37 |
| IUPAC Name | tert-butyl N-benzyl-N-[(2R,3S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]hex-5-en-2-yl]carbamate |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)N(Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H55NO4Si2/c1-15-19-26(35-37(13,14)30(8,9)10)25(23-33-36(11,12)29(5,6)7)31(27(32)34-28(2,3)4)22-24-20-17-16-18-21-24/h15-18,20-21,25-26H,1,19,22-23H2,2-14H3/t25-,26+/m1/s1 |
| InChIKey | BSWMZZFUJQXCOY-FTJBHMTQSA-N |
| XLogP | 8.78 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.95 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|