C33H48O6S — CID 11376580
[(2E,6E,10E,14E)-9-(benzenesulfonyl)-3,7,11,15-tetramethyl-16-(oxan-2-yloxy)hexadeca-2,6,10,14-tetraenyl] acetate (PubChem CID 11376580) has the molecular formula C33H48O6S and a molecular weight of 572.81 g/mol. Its IUPAC name is [(2E,6E,10E,14E)-9-(benzenesulfonyl)-3,7,11,15-tetramethyl-16-(oxan-2-yloxy)hexadeca-2,6,10,14-tetraenyl] acetate.
| Compound Name | [(2E,6E,10E,14E)-9-(benzenesulfonyl)-3,7,11,15-tetramethyl-16-(oxan-2-yloxy)hexadeca-2,6,10,14-tetraenyl] acetate |
|---|---|
| PubChem CID | 11376580 |
| Molecular Formula | C33H48O6S |
| Molecular Weight | 572.81 g/mol |
| Exact Mass | 572.32 |
| IUPAC Name | [(2E,6E,10E,14E)-9-(benzenesulfonyl)-3,7,11,15-tetramethyl-16-(oxan-2-yloxy)hexadeca-2,6,10,14-tetraenyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC/C=C(\C)CC(/C=C(\C)CC/C=C(\C)COC1CCCCO1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C33H48O6S/c1-26(20-22-37-30(5)34)13-11-14-27(2)23-32(40(35,36)31-17-7-6-8-18-31)24-28(3)15-12-16-29(4)25-39-33-19-9-10-21-38-33/h6-8,14,16-18,20,24,32-33H,9-13,15,19,21-23,25H2,1-5H3/b26-20+,27-14+,28-24+,29-16+ |
| InChIKey | PPGNODLCCIAWSR-YIRDZQDBSA-N |
| XLogP | 7.67 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.81 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|