C36H46N6O — CID 11376655
3-methyl-2-(4-methylpiperazin-1-yl)-N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]quinoline-4-carboxamide (PubChem CID 11376655) has the molecular formula C36H46N6O and a molecular weight of 578.81 g/mol. Its IUPAC name is 3-methyl-2-(4-methylpiperazin-1-yl)-N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]quinoline-4-carboxamide.
| Compound Name | 3-methyl-2-(4-methylpiperazin-1-yl)-N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 11376655 |
| Molecular Formula | C36H46N6O |
| Molecular Weight | 578.81 g/mol |
| Exact Mass | 578.37 |
| IUPAC Name | 3-methyl-2-(4-methylpiperazin-1-yl)-N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]quinoline-4-carboxamide |
| SMILES | Cc1c(N2CCN(C)CC2)nc2ccccc2c1C(=O)NCCCCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C36H46N6O/c1-26-33(27-14-6-9-17-30(27)40-35(26)42-24-22-41(2)23-25-42)36(43)38-21-13-5-3-4-12-20-37-34-28-15-7-10-18-31(28)39-32-19-11-8-16-29(32)34/h6-7,9-10,14-15,17-18H,3-5,8,11-13,16,19-25H2,1-2H3,(H,37,39)(H,38,43) |
| InChIKey | ACKJXXOVSOCBPX-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.81 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|