C34H51NO5Si — CID 11376685
methyl (2S,3R,6R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethyl-6-[3-(oxan-2-yloxy)propyl]piperidine-1-carboxylate (PubChem CID 11376685) has the molecular formula C34H51NO5Si and a molecular weight of 581.87 g/mol. Its IUPAC name is methyl (2S,3R,6R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethyl-6-[3-(oxan-2-yloxy)propyl]piperidine-1-carboxylate.
| Compound Name | methyl (2S,3R,6R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethyl-6-[3-(oxan-2-yloxy)propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11376685 |
| Molecular Formula | C34H51NO5Si |
| Molecular Weight | 581.87 g/mol |
| Exact Mass | 581.35 |
| IUPAC Name | methyl (2S,3R,6R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethyl-6-[3-(oxan-2-yloxy)propyl]piperidine-1-carboxylate |
| SMILES | CC[C@@H]1CC[C@H](CCCOC2CCCCO2)N(C(=O)OC)[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H51NO5Si/c1-6-27-22-23-28(16-15-25-39-32-21-13-14-24-38-32)35(33(36)37-5)31(27)26-40-41(34(2,3)4,29-17-9-7-10-18-29)30-19-11-8-12-20-30/h7-12,17-20,27-28,31-32H,6,13-16,21-26H2,1-5H3/t27-,28+,31-,32?/m1/s1 |
| InChIKey | JEYPCUMOHFYLNW-QYOSBEHWSA-N |
| XLogP | 6.51 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.87 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|